Products 166447-71-8
CAS 166447-71-8 appears in our catalog under these names: Farnesol-d6, (E,E)-Farnesol 11,11,11,12,12,12-d6, >95% (HPLC), (E,E)-Farnesol-d6, 98.56%. Offered by: Chemat Brand, TRC, TargetMol, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 1 mg.
(2E,6E)-12,12,12-trideuterio-3,7-dimethyl-11-(trideuteriomethyl)dodeca-2,6,10-trien-1-ol (CAS 166447-71-8) is a chemical compound with the molecular formula C15H26O and a molecular weight of 228.40 g/mol. IUPAC name: (2E,6E)-12,12,12-trideuterio-3,7-dimethyl-11-(trideuteriomethyl)dodeca-2,6,10-trien-1-ol. InChIKey: CRDAMVZIKSXKFV-JPWGLETFSA-N.
| Molecular formula | C15H26O |
|---|---|
| Molecular weight | 228.40 g/mol |
| IUPAC name | (2E,6E)-12,12,12-trideuterio-3,7-dimethyl-11-(trideuteriomethyl)dodeca-2,6,10-trien-1-ol |
| InChIKey | CRDAMVZIKSXKFV-JPWGLETFSA-N |
| SMILES | [2H]C([2H])([2H])C(=CCC/C(=C/CC/C(=C/CO)/C)/C)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)