Products 16650-83-2
CAS 16650-83-2 is the registry number for 5-Amino-9-(diethylamino)benzo[a]phenoxazin-7-ium hydrogen sulfate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium;hydrogen sulfate (CAS 16650-83-2) is a chemical compound with the molecular formula C20H21N3O5S and a molecular weight of 415.5 g/mol. IUPAC name: (5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium;hydrogen sulfate. InChIKey: FQSXHOFWIJVSDY-UHFFFAOYSA-N.
| Molecular formula | C20H21N3O5S |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | (5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium;hydrogen sulfate |
| InChIKey | FQSXHOFWIJVSDY-UHFFFAOYSA-N |
| SMILES | CC[N+](=C1C=CC2=NC3=C(C=C(C4=CC=CC=C43)N)OC2=C1)CC.OS(=O)(=O)[O-] |
Computed by PubChem (NCBI)