CAS 166518-61-2 appears in our catalog under these names: Avasimibe Sodium salt, Avasimibe sodium. Offered by: Chemat Brand, TargetMol. Available pack sizes: on request, 25mg, 50mg, 100mg.
Sodium [2,6-di(propan-2-yl)phenoxy]sulfonyl-[2-[2,4,6-tri(propan-2-yl)phenyl]acetyl]azanide (CAS 166518-61-2) is a chemical compound with the molecular formula C29H42NNaO4S and a molecular weight of 523.7 g/mol. IUPAC name: sodium [2,6-di(propan-2-yl)phenoxy]sulfonyl-[2-[2,4,6-tri(propan-2-yl)phenyl]acetyl]azanide. InChIKey: LENDCHCWVCXELL-UHFFFAOYSA-M.
| Molecular formula | C29H42NNaO4S |
|---|---|
| Molecular weight | 523.7 g/mol |
| IUPAC name | sodium [2,6-di(propan-2-yl)phenoxy]sulfonyl-[2-[2,4,6-tri(propan-2-yl)phenyl]acetyl]azanide |
| InChIKey | LENDCHCWVCXELL-UHFFFAOYSA-M |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)OS(=O)(=O)[N-]C(=O)CC2=C(C=C(C=C2C(C)C)C(C)C)C(C)C.[Na+] |
Computed by PubChem (NCBI)