Products 1665195-94-7
CAS 1665195-94-7 appears in our catalog under these names: BAZ2-ICR, BAZ2-ICR, 97%, BAZ2–ICR, BAZ2-ICR, 99.0%, 99.0%, BAZ2-ICR, 99.95%. Offered by: Chemat Brand, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 50mg, 1mg, 10mg, 25mg, 5mg, 100mg, 500 mg.
4-[5-(1-methylpyrazol-4-yl)-3-[2-(1-methylpyrazol-4-yl)ethyl]imidazol-4-yl]benzonitrile (CAS 1665195-94-7) is a chemical compound with the molecular formula C20H19N7 and a molecular weight of 357.4 g/mol. IUPAC name: 4-[5-(1-methylpyrazol-4-yl)-3-[2-(1-methylpyrazol-4-yl)ethyl]imidazol-4-yl]benzonitrile. InChIKey: RRZVGDGTWNQAPW-UHFFFAOYSA-N.
| Molecular formula | C20H19N7 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 4-[5-(1-methylpyrazol-4-yl)-3-[2-(1-methylpyrazol-4-yl)ethyl]imidazol-4-yl]benzonitrile |
| InChIKey | RRZVGDGTWNQAPW-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)CCN2C=NC(=C2C3=CC=C(C=C3)C#N)C4=CN(N=C4)C |
Computed by PubChem (NCBI)