CAS 166588-20-1 appears in our catalog under these names: 4,4'-Malonyldibenzonitrile, 97%, 4,4'-Malonyldibenzonitrile, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
4-[3-(4-cyanophenyl)-3-oxopropanoyl]benzonitrile (CAS 166588-20-1) is a chemical compound with the molecular formula C17H10N2O2 and a molecular weight of 274.27 g/mol. IUPAC name: 4-[3-(4-cyanophenyl)-3-oxopropanoyl]benzonitrile. InChIKey: LZVNVZXXLUCDLL-UHFFFAOYSA-N.
| Molecular formula | C17H10N2O2 |
|---|---|
| Molecular weight | 274.27 g/mol |
| IUPAC name | 4-[3-(4-cyanophenyl)-3-oxopropanoyl]benzonitrile |
| InChIKey | LZVNVZXXLUCDLL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C(=O)CC(=O)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)