CAS 1666125-12-7 is the registry number for 2-(2-Bromo-4-fluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-bromo-4-fluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (CAS 1666125-12-7) is a chemical compound with the molecular formula C9H4BrF7O and a molecular weight of 341.02 g/mol. IUPAC name: 2-(2-bromo-4-fluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol. InChIKey: YDLYDCZFFTVUSM-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF7O |
|---|---|
| Molecular weight | 341.02 g/mol |
| IUPAC name | 2-(2-bromo-4-fluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| InChIKey | YDLYDCZFFTVUSM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)