Products 1666134-58-2
CAS 1666134-58-2 is the registry number for Antibacterial agent 94. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-[(E)-2-(2-fluorophenyl)ethenyl]-2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)benzoic acid (CAS 1666134-58-2) is a chemical compound with the molecular formula C21H21FO4 and a molecular weight of 356.4 g/mol. IUPAC name: 6-[(E)-2-(2-fluorophenyl)ethenyl]-2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)benzoic acid. InChIKey: MFKZKBCPPHOYBX-MDZDMXLPSA-N.
| Molecular formula | C21H21FO4 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 6-[(E)-2-(2-fluorophenyl)ethenyl]-2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)benzoic acid |
| InChIKey | MFKZKBCPPHOYBX-MDZDMXLPSA-N |
| SMILES | CC(=CCC1=C(C=C(C(=C1O)C(=O)O)/C=C/C2=CC=CC=C2F)OC)C |
Computed by PubChem (NCBI)
Synonyms:
Antibacterial agent 94, orb1688754