CAS 16662-85-4 appears in our catalog under these names: Carbophenothion Sulfone, Carbophenothion-sulfone. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 100mg, 25mg.
(4-chlorophenyl)sulfonylmethylsulfanyl-diethoxy-sulfanylidene-lambda5-phosphane (CAS 16662-85-4) is a chemical compound with the molecular formula C11H16ClO4PS3 and a molecular weight of 374.9 g/mol. IUPAC name: (4-chlorophenyl)sulfonylmethylsulfanyl-diethoxy-sulfanylidene-lambda5-phosphane. InChIKey: CBXRYOZUHFXMRF-UHFFFAOYSA-N.
| Molecular formula | C11H16ClO4PS3 |
|---|---|
| Molecular weight | 374.9 g/mol |
| IUPAC name | (4-chlorophenyl)sulfonylmethylsulfanyl-diethoxy-sulfanylidene-lambda5-phosphane |
| InChIKey | CBXRYOZUHFXMRF-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)SCS(=O)(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)