Products 16670-83-0
CAS 16670-83-0 is the registry number for (+)-Normetazocine. Offered by: TRC. Available pack sizes: 250mg.
(1S,9S,13S)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol (CAS 16670-83-0) is a chemical compound with the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. IUPAC name: (1S,9S,13S)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol. InChIKey: DXESFJJJWBHLJX-IIMNLJJBSA-N.
| Molecular formula | C14H19NO |
|---|---|
| Molecular weight | 217.31 g/mol |
| IUPAC name | (1S,9S,13S)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
| InChIKey | DXESFJJJWBHLJX-IIMNLJJBSA-N |
| SMILES | C[C@@H]1[C@@H]2CC3=C([C@]1(CCN2)C)C=C(C=C3)O |
Computed by PubChem (NCBI)