CAS 16672-78-9 is the registry number for 4-Cyanophenylphosphonic Acid. Offered by: TRC. Available pack sizes: 1g.
(4-cyanophenyl)phosphonic acid (CAS 16672-78-9) is a chemical compound with the molecular formula C7H6NO3P and a molecular weight of 183.10 g/mol. IUPAC name: (4-cyanophenyl)phosphonic acid. InChIKey: VRNGJVDKKRAVFE-UHFFFAOYSA-N.
| Molecular formula | C7H6NO3P |
|---|---|
| Molecular weight | 183.10 g/mol |
| IUPAC name | (4-cyanophenyl)phosphonic acid |
| InChIKey | VRNGJVDKKRAVFE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)P(=O)(O)O |
Computed by PubChem (NCBI)