CAS 166773-08-6 is the registry number for 1,3,4-Triphenyl-4,5-dihydro-1H-1,2,4-triazol-5-ylidene. Offered by: Thermo Scientific (Acros). Available pack sizes: 1g.
2,4,5-triphenyl-3H-1,2,4-triazole (CAS 166773-08-6) is a chemical compound with the molecular formula C20H17N3 and a molecular weight of 299.4 g/mol. IUPAC name: 2,4,5-triphenyl-3H-1,2,4-triazole. InChIKey: NNVGTIRYCCWRSL-UHFFFAOYSA-N.
| Molecular formula | C20H17N3 |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | 2,4,5-triphenyl-3H-1,2,4-triazole |
| InChIKey | NNVGTIRYCCWRSL-UHFFFAOYSA-N |
| SMILES | C1N(C(=NN1C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)