CAS 16680-48-1 appears in our catalog under these names: Equilenin Impurity 1, Equilenin Sulfate Sodium Salt, Equilenin Sulfate Sodium Salt (stabilized with TRIS, 50% w/w), >95% (HPLC). Offered by: Hubei YoungXin, Chemat Brand, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 2,5mg.
Sodium [(13S,14S)-13-methyl-17-oxo-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-3-yl] sulfate (CAS 16680-48-1) is a chemical compound with the molecular formula C18H17NaO5S and a molecular weight of 368.4 g/mol. IUPAC name: sodium [(13S,14S)-13-methyl-17-oxo-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-3-yl] sulfate. InChIKey: QMLVWIVCALQEEX-AKXYIILFSA-M.
| Molecular formula | C18H17NaO5S |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | sodium [(13S,14S)-13-methyl-17-oxo-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-3-yl] sulfate |
| InChIKey | QMLVWIVCALQEEX-AKXYIILFSA-M |
| SMILES | C[C@]12CCC3=C([C@@H]1CCC2=O)C=CC4=C3C=CC(=C4)OS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)