CAS 16680-49-2 appears in our catalog under these names: 17β-Dihydro Equilin 3-Sulfate Sodium Salt, 17beta-Dihydro Equilin 3-Sulfate Sodium Salt, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5mg, 25mg.
Sodium [(9S,13S,14S,17S)-17-hydroxy-13-methyl-6,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-yl] sulfate (CAS 16680-49-2) is a chemical compound with the molecular formula C18H21NaO5S and a molecular weight of 372.4 g/mol. IUPAC name: sodium [(9S,13S,14S,17S)-17-hydroxy-13-methyl-6,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-yl] sulfate. InChIKey: CZFNZYFVJFYZML-UHFFLUDVSA-M.
| Molecular formula | C18H21NaO5S |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | sodium [(9S,13S,14S,17S)-17-hydroxy-13-methyl-6,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-yl] sulfate |
| InChIKey | CZFNZYFVJFYZML-UHFFLUDVSA-M |
| SMILES | C[C@]12CC[C@H]3C(=CCC4=C3C=CC(=C4)OS(=O)(=O)[O-])[C@@H]1CC[C@@H]2O.[Na+] |
Computed by PubChem (NCBI)