CAS 16680-50-5 appears in our catalog under these names: 17β-Dihydro Equilenin 3-Sulfate Sodium Salt, 17beta-Dihydro Equilenin 3-Sulfate Sodium Salt (Stabilized with TRIS, 50% w/w), >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg, 50mg, 5mg.
Sodium [(13S,14S,17S)-17-hydroxy-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-3-yl] sulfate (CAS 16680-50-5) is a chemical compound with the molecular formula C18H19NaO5S and a molecular weight of 370.4 g/mol. IUPAC name: sodium [(13S,14S,17S)-17-hydroxy-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-3-yl] sulfate. InChIKey: HBVSSZJQFZAJLK-UVJOBNTFSA-M.
| Molecular formula | C18H19NaO5S |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | sodium [(13S,14S,17S)-17-hydroxy-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-3-yl] sulfate |
| InChIKey | HBVSSZJQFZAJLK-UVJOBNTFSA-M |
| SMILES | C[C@]12CCC3=C([C@@H]1CC[C@@H]2O)C=CC4=C3C=CC(=C4)OS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)