CAS 1668604-47-4 is the registry number for ZINC09659342. Offered by: MedChemExpress. Available pack sizes: 1 mg, 10 mg, 5 mg, 50 mg, 25 mg.
4-[(4Z)-3-methyl-5-oxo-4-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]pyrazol-1-yl]benzoic acid (CAS 1668604-47-4) is a chemical compound with the molecular formula C23H15F3N2O4 and a molecular weight of 440.4 g/mol. IUPAC name: 4-[(4Z)-3-methyl-5-oxo-4-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]pyrazol-1-yl]benzoic acid. InChIKey: SFVRJPWNVAZKMP-UNOMPAQXSA-N.
| Molecular formula | C23H15F3N2O4 |
|---|---|
| Molecular weight | 440.4 g/mol |
| IUPAC name | 4-[(4Z)-3-methyl-5-oxo-4-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]pyrazol-1-yl]benzoic acid |
| InChIKey | SFVRJPWNVAZKMP-UNOMPAQXSA-N |
| SMILES | CC\1=NN(C(=O)/C1=C\C2=CC=C(O2)C3=CC(=CC=C3)C(F)(F)F)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)