CAS 166907-09-1 is the registry number for Benzyl 2-azido-2-deoxy-a-D-galactopyranoside. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 250mg, 100mg.
(2R,3R,4R,5R,6S)-5-azido-2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4-diol (CAS 166907-09-1) is a chemical compound with the molecular formula C13H17N3O5 and a molecular weight of 295.29 g/mol. IUPAC name: (2R,3R,4R,5R,6S)-5-azido-2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4-diol. InChIKey: NZPDOBJGGCDISD-LBELIVKGSA-N.
| Molecular formula | C13H17N3O5 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | (2R,3R,4R,5R,6S)-5-azido-2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4-diol |
| InChIKey | NZPDOBJGGCDISD-LBELIVKGSA-N |
| SMILES | C1=CC=C(C=C1)CO[C@@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)