Products 1669444-50-1
CAS 1669444-50-1 appears in our catalog under these names: PF 05214030, min. 95 %, 1 mg, PF–05214030, PF 05214030, PF-05214030, 99.81%, PF 05214030, min. 95 %, 2 mg. Offered by: Roth, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 2mg, 10mM/1mL, 100 mg.
4-[[1-(2,4-dichlorophenyl)sulfonyl-3-hydroxyazetidin-3-yl]methoxy]-2-fluorobenzonitrile (CAS 1669444-50-1) is a chemical compound with the molecular formula C17H13Cl2FN2O4S and a molecular weight of 431.3 g/mol. IUPAC name: 4-[[1-(2,4-dichlorophenyl)sulfonyl-3-hydroxyazetidin-3-yl]methoxy]-2-fluorobenzonitrile. InChIKey: RZAIRBXIVAVGHE-UHFFFAOYSA-N.
| Molecular formula | C17H13Cl2FN2O4S |
|---|---|
| Molecular weight | 431.3 g/mol |
| IUPAC name | 4-[[1-(2,4-dichlorophenyl)sulfonyl-3-hydroxyazetidin-3-yl]methoxy]-2-fluorobenzonitrile |
| InChIKey | RZAIRBXIVAVGHE-UHFFFAOYSA-N |
| SMILES | C1C(CN1S(=O)(=O)C2=C(C=C(C=C2)Cl)Cl)(COC3=CC(=C(C=C3)C#N)F)O |
Computed by PubChem (NCBI)
Synonyms:
C17H13Cl2FN2O4S, orb1739181