CAS 166964-26-7 appears in our catalog under these names: 2,5-Dimethyl-3-furansulfonyl chloride, 95%, 2,5-Dimethylfuran-3-sulfonyl chloride, 95+%, 2,5-Dimethyl-3-furansulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 10g, 5g, 2,5g.
2,5-dimethylfuran-3-sulfonyl chloride (CAS 166964-26-7) is a chemical compound with the molecular formula C6H7ClO3S and a molecular weight of 194.64 g/mol. IUPAC name: 2,5-dimethylfuran-3-sulfonyl chloride. InChIKey: PIXAQZAVANAGLE-UHFFFAOYSA-N.
| Molecular formula | C6H7ClO3S |
|---|---|
| Molecular weight | 194.64 g/mol |
| IUPAC name | 2,5-dimethylfuran-3-sulfonyl chloride |
| InChIKey | PIXAQZAVANAGLE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(O1)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)