CAS 166964-31-4 is the registry number for 2-[1-Methyl-5-(trifluoromethyl)pyrazol-3-yl]-thiophene-5-sulfonyl chloride. Offered by: Fluorochem. Available pack sizes: 250mg, 1g.
5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophene-2-sulfonyl chloride (CAS 166964-31-4) is a chemical compound with the molecular formula C9H6ClF3N2O2S2 and a molecular weight of 330.7 g/mol. IUPAC name: 5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophene-2-sulfonyl chloride. InChIKey: BWVNHXIGDZASCP-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3N2O2S2 |
|---|---|
| Molecular weight | 330.7 g/mol |
| IUPAC name | 5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophene-2-sulfonyl chloride |
| InChIKey | BWVNHXIGDZASCP-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C2=CC=C(S2)S(=O)(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)