Products 1670260-03-3
CAS 1670260-03-3 is the registry number for tert-butyl (3R)-3-hydroxy-3-(trifluoromethyl)piperidine-1-carboxylate. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (3R)-3-hydroxy-3-(trifluoromethyl)piperidine-1-carboxylate (CAS 1670260-03-3) is a chemical compound with the molecular formula C11H18F3NO3 and a molecular weight of 269.26 g/mol. IUPAC name: tert-butyl (3R)-3-hydroxy-3-(trifluoromethyl)piperidine-1-carboxylate. InChIKey: QYOHWKPQQOXOFE-SNVBAGLBSA-N.
| Molecular formula | C11H18F3NO3 |
|---|---|
| Molecular weight | 269.26 g/mol |
| IUPAC name | tert-butyl (3R)-3-hydroxy-3-(trifluoromethyl)piperidine-1-carboxylate |
| InChIKey | QYOHWKPQQOXOFE-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@](C1)(C(F)(F)F)O |
Computed by PubChem (NCBI)