Products 1671025-91-4
CAS 1671025-91-4 is the registry number for Y12196. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[2-(2,4-dichlorophenoxy)phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide (CAS 1671025-91-4) is a chemical compound with the molecular formula C18H13Cl2F2N3O2 and a molecular weight of 412.2 g/mol. IUPAC name: N-[2-(2,4-dichlorophenoxy)phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide. InChIKey: DEBMUZVVCQOQFN-UHFFFAOYSA-N.
| Molecular formula | C18H13Cl2F2N3O2 |
|---|---|
| Molecular weight | 412.2 g/mol |
| IUPAC name | N-[2-(2,4-dichlorophenoxy)phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide |
| InChIKey | DEBMUZVVCQOQFN-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(F)F)C(=O)NC2=CC=CC=C2OC3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)