CAS 16715-83-6 appears in our catalog under these names: 2-(Diisopropylamino)ethyl methacrylate, 97%, 2–(Diisopropylamino)ethyl methacrylate(stabilizedwithMEHQ), 2-(Diisopropylamino)ethyl Methacrylate (stabilized with MEHQ), >98.0%(GC), 2-(Diisopropylamino)ethyl Methacrylate, 2-(DIISOPROPYLAMINO)ETHYL METHACRYLATE,&. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 100g, 5g, 25g, 1g, 500g.
2-[di(propan-2-yl)amino]ethyl 2-methylprop-2-enoate (CAS 16715-83-6) is a chemical compound with the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. IUPAC name: 2-[di(propan-2-yl)amino]ethyl 2-methylprop-2-enoate. InChIKey: SVYHMICYJHWXIN-UHFFFAOYSA-N.
| Molecular formula | C12H23NO2 |
|---|---|
| Molecular weight | 213.32 g/mol |
| IUPAC name | 2-[di(propan-2-yl)amino]ethyl 2-methylprop-2-enoate |
| InChIKey | SVYHMICYJHWXIN-UHFFFAOYSA-N |
| SMILES | CC(C)N(CCOC(=O)C(=C)C)C(C)C |
Computed by PubChem (NCBI)