Products 167158-69-2
CAS 167158-69-2 is the registry number for 6-Bromo-3-propyl-2-sulfanyl-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
6-bromo-3-propyl-2-sulfanylidene-1H-quinazolin-4-one (CAS 167158-69-2) is a chemical compound with the molecular formula C11H11BrN2OS and a molecular weight of 299.19 g/mol. IUPAC name: 6-bromo-3-propyl-2-sulfanylidene-1H-quinazolin-4-one. InChIKey: NTEIOPJYCDSWMD-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2OS |
|---|---|
| Molecular weight | 299.19 g/mol |
| IUPAC name | 6-bromo-3-propyl-2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | NTEIOPJYCDSWMD-UHFFFAOYSA-N |
| SMILES | CCCN1C(=O)C2=C(C=CC(=C2)Br)NC1=S |
Computed by PubChem (NCBI)