CAS 167171-03-1 appears in our catalog under these names: (4R)–2–(2–(Diphenylphosphino)phenyl)–4,5–dihydro–4–phenyloxazole, (R)-(-)-2-[2-(Diphenylphosphino)phenyl]-4-phenyl-1,3-oxazoline, 98% 99%ee, 98% 99%ee, (R)-Ph-Phox, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 50mg, 1g, 5g.
Diphenyl-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane (CAS 167171-03-1) is a chemical compound with the molecular formula C27H22NOP and a molecular weight of 407.4 g/mol. IUPAC name: diphenyl-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane. InChIKey: OKUTYUNUKKPYJS-VWLOTQADSA-N.
| Molecular formula | C27H22NOP |
|---|---|
| Molecular weight | 407.4 g/mol |
| IUPAC name | diphenyl-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane |
| InChIKey | OKUTYUNUKKPYJS-VWLOTQADSA-N |
| SMILES | C1[C@H](N=C(O1)C2=CC=CC=C2P(C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)