CAS 167262-68-2 appears in our catalog under these names: Ph-Pip(Boc)-OH, 1-(tert-butoxycarbonyl)-4-phenyl-4-piperidinecarboxylic acid, 98%, 98%, 4-Phenyl-piperidine-1,4-dicarboxylic acidmono-tert-butyl ester, 97%. Offered by: Iris Biotech, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg, 10g.
1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylpiperidine-4-carboxylic acid (CAS 167262-68-2) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylpiperidine-4-carboxylic acid. InChIKey: ZDWOYDIXKYSZPX-UHFFFAOYSA-N.
| Molecular formula | C17H23NO4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylpiperidine-4-carboxylic acid |
| InChIKey | ZDWOYDIXKYSZPX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)