CAS 1672661-79-8 appears in our catalog under these names: 4-Fluoro-7-mercapto-2,3-dihydro-1H-inden-1-one, 95%, 4-Fluoro-7-mercapto-2,3-dihydro-1H-inden-1-one, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
4-fluoro-7-sulfanyl-2,3-dihydroinden-1-one (CAS 1672661-79-8) is a chemical compound with the molecular formula C9H7FOS and a molecular weight of 182.22 g/mol. IUPAC name: 4-fluoro-7-sulfanyl-2,3-dihydroinden-1-one. InChIKey: PWDOMZGBJVKAAL-UHFFFAOYSA-N.
| Molecular formula | C9H7FOS |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 4-fluoro-7-sulfanyl-2,3-dihydroinden-1-one |
| InChIKey | PWDOMZGBJVKAAL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)F)S |
Computed by PubChem (NCBI)