Products 1672661-80-1
CAS 1672661-80-1 is the registry number for 7-((Difluoromethyl)thio)-4-fluoro-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-(difluoromethylsulfanyl)-4-fluoro-2,3-dihydroinden-1-one (CAS 1672661-80-1) is a chemical compound with the molecular formula C10H7F3OS and a molecular weight of 232.22 g/mol. IUPAC name: 7-(difluoromethylsulfanyl)-4-fluoro-2,3-dihydroinden-1-one. InChIKey: HETSWFDJDIQHOI-UHFFFAOYSA-N.
| Molecular formula | C10H7F3OS |
|---|---|
| Molecular weight | 232.22 g/mol |
| IUPAC name | 7-(difluoromethylsulfanyl)-4-fluoro-2,3-dihydroinden-1-one |
| InChIKey | HETSWFDJDIQHOI-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)F)SC(F)F |
Computed by PubChem (NCBI)