CAS 1672661-81-2 appears in our catalog under these names: 7-((Difluoromethyl)sulfonyl)-4-fluoro-2,3-dihydro-1H-inden-1-one, 98%, 98%, 7-((Difluoromethyl)sulfonyl)-4-fluoro-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
7-(difluoromethylsulfonyl)-4-fluoro-2,3-dihydroinden-1-one (CAS 1672661-81-2) is a chemical compound with the molecular formula C10H7F3O3S and a molecular weight of 264.22 g/mol. IUPAC name: 7-(difluoromethylsulfonyl)-4-fluoro-2,3-dihydroinden-1-one. InChIKey: YTNBHEVBBAOOMG-UHFFFAOYSA-N.
| Molecular formula | C10H7F3O3S |
|---|---|
| Molecular weight | 264.22 g/mol |
| IUPAC name | 7-(difluoromethylsulfonyl)-4-fluoro-2,3-dihydroinden-1-one |
| InChIKey | YTNBHEVBBAOOMG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)F)S(=O)(=O)C(F)F |
Computed by PubChem (NCBI)