CAS 16739-21-2 appears in our catalog under these names: Niclosamide Impurity 2, 3,5-Dichloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
3,5-dichloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide (CAS 16739-21-2) is a chemical compound with the molecular formula C13H7Cl3N2O4 and a molecular weight of 361.6 g/mol. IUPAC name: 3,5-dichloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide. InChIKey: MNCDXBIGADXSNN-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl3N2O4 |
|---|---|
| Molecular weight | 361.6 g/mol |
| IUPAC name | 3,5-dichloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |
| InChIKey | MNCDXBIGADXSNN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)NC(=O)C2=C(C(=CC(=C2)Cl)Cl)O |
Computed by PubChem (NCBI)