CAS 167396-23-8 is the registry number for Aranose. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-methyl-1-nitroso-3-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]urea (CAS 167396-23-8) is a chemical compound with the molecular formula C7H13N3O6 and a molecular weight of 235.19 g/mol. IUPAC name: 1-methyl-1-nitroso-3-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]urea. InChIKey: BADMGRJDJPQBLS-UNTFVMJOSA-N.
| Molecular formula | C7H13N3O6 |
|---|---|
| Molecular weight | 235.19 g/mol |
| IUPAC name | 1-methyl-1-nitroso-3-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]urea |
| InChIKey | BADMGRJDJPQBLS-UNTFVMJOSA-N |
| SMILES | CN(C(=O)N[C@H]1[C@@H]([C@H]([C@H](CO1)O)O)O)N=O |
Computed by PubChem (NCBI)