CAS 1674-99-3 is the registry number for Denatonium Chloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
Benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium chloride (CAS 1674-99-3) is a chemical compound with the molecular formula C21H29ClN2O and a molecular weight of 360.9 g/mol. IUPAC name: benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium chloride. InChIKey: YNQALPDYZRNHNK-UHFFFAOYSA-N.
| Molecular formula | C21H29ClN2O |
|---|---|
| Molecular weight | 360.9 g/mol |
| IUPAC name | benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium chloride |
| InChIKey | YNQALPDYZRNHNK-UHFFFAOYSA-N |
| SMILES | CC[N+](CC)(CC1=CC=CC=C1)CC(=O)NC2=C(C=CC=C2C)C.[Cl-] |
Computed by PubChem (NCBI)