Products 1674-99-3

CAS 1674-99-3 is the registry number for Denatonium Chloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.

Structural formula: {0} (CAS {1})

Benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium chloride (CAS 1674-99-3) is a chemical compound with the molecular formula C21H29ClN2O and a molecular weight of 360.9 g/mol. IUPAC name: benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium chloride. InChIKey: YNQALPDYZRNHNK-UHFFFAOYSA-N.

Identity
Molecular formulaC21H29ClN2O
Molecular weight360.9 g/mol
IUPAC namebenzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium chloride
InChIKeyYNQALPDYZRNHNK-UHFFFAOYSA-N
SMILESCC[N+](CC)(CC1=CC=CC=C1)CC(=O)NC2=C(C=CC=C2C)C.[Cl-]

Computed by PubChem (NCBI)