CAS 16741-27-8 appears in our catalog under these names: Acetobromofucose, 95%, (2S,3S,4R,5R,6S)–2–bromo–6–methyltetrahydro–2H–pyran–3,4,5–triyl triacetate, Acetobromofucose, 2,3,4-Tri-O-acetyl-a-L-fucopyranosyl bromide, α-L-Galactopyranosyl bromide,6-deoxy,2,3,4-triacetate. Offered by: Combi-blocks, GLPBio, Chemat, Biosynth, MedChemExpress. Available pack sizes: 250mg, 100mg, 1g, 2g, 500mg, 0,5g, 0,25g, 5g.
[(2S,3R,4R,5S,6S)-4,5-diacetyloxy-6-bromo-2-methyloxan-3-yl] acetate (CAS 16741-27-8) is a chemical compound with the molecular formula C12H17BrO7 and a molecular weight of 353.16 g/mol. IUPAC name: [(2S,3R,4R,5S,6S)-4,5-diacetyloxy-6-bromo-2-methyloxan-3-yl] acetate. InChIKey: XUZQAPSYNYIKSR-BSOOIWJMSA-N.
| Molecular formula | C12H17BrO7 |
|---|---|
| Molecular weight | 353.16 g/mol |
| IUPAC name | [(2S,3R,4R,5S,6S)-4,5-diacetyloxy-6-bromo-2-methyloxan-3-yl] acetate |
| InChIKey | XUZQAPSYNYIKSR-BSOOIWJMSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)Br)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)