Products 1674390-09-0

CAS 1674390-09-0 is the registry number for (3-Bromo-5-methoxy-1h-1,2,4-triazol-1-yl)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-bromo-5-methoxy-1,2,4-triazol-1-yl)acetic acid (CAS 1674390-09-0) is a chemical compound with the molecular formula C5H6BrN3O3 and a molecular weight of 236.02 g/mol. IUPAC name: 2-(3-bromo-5-methoxy-1,2,4-triazol-1-yl)acetic acid. InChIKey: SDFSPGQYQCXCMV-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6BrN3O3
Molecular weight236.02 g/mol
IUPAC name2-(3-bromo-5-methoxy-1,2,4-triazol-1-yl)acetic acid
InChIKeySDFSPGQYQCXCMV-UHFFFAOYSA-N
SMILESCOC1=NC(=NN1CC(=O)O)Br

Computed by PubChem (NCBI)