CAS 1674390-10-3 appears in our catalog under these names: [3-Bromo-5-(dimethylamino)-1h-1,2,4-triazol-1-yl]acetic acid, 95%, (3-BRomo-5-(dimethylamino)-1h-1,2,4-triazol-1-yl)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-[3-bromo-5-(dimethylamino)-1,2,4-triazol-1-yl]acetic acid (CAS 1674390-10-3) is a chemical compound with the molecular formula C6H9BrN4O2 and a molecular weight of 249.07 g/mol. IUPAC name: 2-[3-bromo-5-(dimethylamino)-1,2,4-triazol-1-yl]acetic acid. InChIKey: LJFFSMZVXNEHEV-UHFFFAOYSA-N.
| Molecular formula | C6H9BrN4O2 |
|---|---|
| Molecular weight | 249.07 g/mol |
| IUPAC name | 2-[3-bromo-5-(dimethylamino)-1,2,4-triazol-1-yl]acetic acid |
| InChIKey | LJFFSMZVXNEHEV-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=NN1CC(=O)O)Br |
Computed by PubChem (NCBI)