CAS 167482-91-9 is the registry number for 5-(Pentafluorophenyl)dipyrromethane, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
2-[(2,3,4,5,6-pentafluorophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole (CAS 167482-91-9) is a chemical compound with the molecular formula C15H9F5N2 and a molecular weight of 312.24 g/mol. IUPAC name: 2-[(2,3,4,5,6-pentafluorophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole. InChIKey: XCGQROJURKZJOU-UHFFFAOYSA-N.
| Molecular formula | C15H9F5N2 |
|---|---|
| Molecular weight | 312.24 g/mol |
| IUPAC name | 2-[(2,3,4,5,6-pentafluorophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole |
| InChIKey | XCGQROJURKZJOU-UHFFFAOYSA-N |
| SMILES | C1=CNC(=C1)C(C2=CC=CN2)C3=C(C(=C(C(=C3F)F)F)F)F |
Computed by PubChem (NCBI)