CAS 1675-43-0 is the registry number for 10-(3-Bromopropyl)-2-(trifluoromethyl)-10H-phenothiazine. Offered by: TRC. Available pack sizes: 5g.
10-(3-bromopropyl)-2-(trifluoromethyl)phenothiazine (CAS 1675-43-0) is a chemical compound with the molecular formula C16H13BrF3NS and a molecular weight of 388.2 g/mol. IUPAC name: 10-(3-bromopropyl)-2-(trifluoromethyl)phenothiazine. InChIKey: NDSHSMWAEIJPRG-UHFFFAOYSA-N.
| Molecular formula | C16H13BrF3NS |
|---|---|
| Molecular weight | 388.2 g/mol |
| IUPAC name | 10-(3-bromopropyl)-2-(trifluoromethyl)phenothiazine |
| InChIKey | NDSHSMWAEIJPRG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C3=C(S2)C=CC(=C3)C(F)(F)F)CCCBr |
Computed by PubChem (NCBI)