CAS 1675201-83-8 appears in our catalog under these names: PD-1 (PD-L1 Inhibitor 1), BMS-1/ 99.86% (existing batch purity), PD–1/PD–L1 inhibitor 1 (BMS–1), PD1-PDL1 inhibitor 1, BMS-1 98%. Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
(2S)-1-[[2,6-dimethoxy-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methyl]piperidine-2-carboxylic acid (CAS 1675201-83-8) is a chemical compound with the molecular formula C29H33NO5 and a molecular weight of 475.6 g/mol. IUPAC name: (2S)-1-[[2,6-dimethoxy-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methyl]piperidine-2-carboxylic acid. InChIKey: ZBOYJODMIAUJHH-SANMLTNESA-N.
| Molecular formula | C29H33NO5 |
|---|---|
| Molecular weight | 475.6 g/mol |
| IUPAC name | (2S)-1-[[2,6-dimethoxy-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methyl]piperidine-2-carboxylic acid |
| InChIKey | ZBOYJODMIAUJHH-SANMLTNESA-N |
| SMILES | CC1=C(C=CC=C1C2=CC=CC=C2)COC3=CC(=C(C(=C3)OC)CN4CCCC[C@H]4C(=O)O)OC |
Computed by PubChem (NCBI)