CAS 16759-59-4 is the registry number for Benoxafos. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5,7-dichloro-1,3-benzoxazol-2-yl)methylsulfanyl-diethoxy-sulfanylidene-lambda5-phosphane (CAS 16759-59-4) is a chemical compound with the molecular formula C12H14Cl2NO3PS2 and a molecular weight of 386.3 g/mol. IUPAC name: (5,7-dichloro-1,3-benzoxazol-2-yl)methylsulfanyl-diethoxy-sulfanylidene-lambda5-phosphane. InChIKey: KEZAYQGUTKCBLO-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2NO3PS2 |
|---|---|
| Molecular weight | 386.3 g/mol |
| IUPAC name | (5,7-dichloro-1,3-benzoxazol-2-yl)methylsulfanyl-diethoxy-sulfanylidene-lambda5-phosphane |
| InChIKey | KEZAYQGUTKCBLO-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)SCC1=NC2=C(O1)C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)