Products 167710-69-2

CAS 167710-69-2 is the registry number for Ethyl 2-methyl-2-(piperidin-4-yl)propanoate hydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-methyl-2-piperidin-4-ylpropanoate (CAS 167710-69-2) is a chemical compound with the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. IUPAC name: ethyl 2-methyl-2-piperidin-4-ylpropanoate. InChIKey: SXQUKTMPHDAHMN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H21NO2
Molecular weight199.29 g/mol
IUPAC nameethyl 2-methyl-2-piperidin-4-ylpropanoate
InChIKeySXQUKTMPHDAHMN-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)(C)C1CCNCC1

Computed by PubChem (NCBI)