Products 1678501-16-0
CAS 1678501-16-0 is the registry number for mGlu4 receptor agonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-3-methylphenyl]pyridine-2-carboxamide (CAS 1678501-16-0) is a chemical compound with the molecular formula C21H15ClN4O2 and a molecular weight of 390.8 g/mol. IUPAC name: N-[4-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-3-methylphenyl]pyridine-2-carboxamide. InChIKey: RNDMJFKGWGEUBH-UHFFFAOYSA-N.
| Molecular formula | C21H15ClN4O2 |
|---|---|
| Molecular weight | 390.8 g/mol |
| IUPAC name | N-[4-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-3-methylphenyl]pyridine-2-carboxamide |
| InChIKey | RNDMJFKGWGEUBH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)C2=CC=CC=N2)C3=NOC(=N3)C4=CC=CC=C4Cl |
Computed by PubChem (NCBI)
Synonyms:
mGlu4 receptor agonist 1, orb1688263