Products 1678513-93-3

CAS 1678513-93-3 appears in our catalog under these names: 2,5–Bis(methylthio)benzene–1,4–diamine, 2,5-Bis(methylthio)benzene-1,4-diamine 98%, 2,5-Bis(methylthio)benzene-1,4-diamine, 98%, 98%, 2,5-Bis(methylthio)benzene-1,4-diamine, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 500mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2,5-bis(methylsulfanyl)benzene-1,4-diamine (CAS 1678513-93-3) is a chemical compound with the molecular formula C8H12N2S2 and a molecular weight of 200.3 g/mol. IUPAC name: 2,5-bis(methylsulfanyl)benzene-1,4-diamine. InChIKey: SZNJCOFPTHFIEU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12N2S2
Molecular weight200.3 g/mol
IUPAC name2,5-bis(methylsulfanyl)benzene-1,4-diamine
InChIKeySZNJCOFPTHFIEU-UHFFFAOYSA-N
SMILESCSC1=CC(=C(C=C1N)SC)N

Computed by PubChem (NCBI)