Products 1678513-97-7

CAS 1678513-97-7 appears in our catalog under these names: 2,5-Bis(methylsulfonyl)benzene-1,4-diamine, 95%, 2,5–Bis(methylsulfonyl)benzene–1,4–diamine, BMeS-p-A, >95.0%(HPLC), BMeS-p-A, 2,5-Bis(methylsulfonyl)benzene-1,4-diamine, 98%. Offered by: AmBeed, GLPBio, TCI, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 200mg, 100mg, 500mg, 1000mg.

Structural formula: {0} (CAS {1})

2,5-bis(methylsulfonyl)benzene-1,4-diamine (CAS 1678513-97-7) is a chemical compound with the molecular formula C8H12N2O4S2 and a molecular weight of 264.3 g/mol. IUPAC name: 2,5-bis(methylsulfonyl)benzene-1,4-diamine. InChIKey: PBKAXANOUZYEDU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12N2O4S2
Molecular weight264.3 g/mol
IUPAC name2,5-bis(methylsulfonyl)benzene-1,4-diamine
InChIKeyPBKAXANOUZYEDU-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CC(=C(C=C1N)S(=O)(=O)C)N

Computed by PubChem (NCBI)