CAS 1678513-97-7 appears in our catalog under these names: 2,5-Bis(methylsulfonyl)benzene-1,4-diamine, 95%, 2,5–Bis(methylsulfonyl)benzene–1,4–diamine, BMeS-p-A, >95.0%(HPLC), BMeS-p-A, 2,5-Bis(methylsulfonyl)benzene-1,4-diamine, 98%. Offered by: AmBeed, GLPBio, TCI, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 200mg, 100mg, 500mg, 1000mg.
2,5-bis(methylsulfonyl)benzene-1,4-diamine (CAS 1678513-97-7) is a chemical compound with the molecular formula C8H12N2O4S2 and a molecular weight of 264.3 g/mol. IUPAC name: 2,5-bis(methylsulfonyl)benzene-1,4-diamine. InChIKey: PBKAXANOUZYEDU-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O4S2 |
|---|---|
| Molecular weight | 264.3 g/mol |
| IUPAC name | 2,5-bis(methylsulfonyl)benzene-1,4-diamine |
| InChIKey | PBKAXANOUZYEDU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1N)S(=O)(=O)C)N |
Computed by PubChem (NCBI)