CAS 1678527-92-8 is the registry number for ((1S,2S)-2-(4-Iodophenyl)cyclopropyl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,2S)-2-(4-iodophenyl)cyclopropyl]methanol (CAS 1678527-92-8) is a chemical compound with the molecular formula C10H11IO and a molecular weight of 274.10 g/mol. IUPAC name: [(1S,2S)-2-(4-iodophenyl)cyclopropyl]methanol. InChIKey: PTSGLUWJCUTITI-PSASIEDQSA-N.
| Molecular formula | C10H11IO |
|---|---|
| Molecular weight | 274.10 g/mol |
| IUPAC name | [(1S,2S)-2-(4-iodophenyl)cyclopropyl]methanol |
| InChIKey | PTSGLUWJCUTITI-PSASIEDQSA-N |
| SMILES | C1[C@@H]([C@H]1C2=CC=C(C=C2)I)CO |
Computed by PubChem (NCBI)