CAS 16790-64-0 is the registry number for Adamantan-1-amine formate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Adamantan-1-amine;formic acid (CAS 16790-64-0) is a chemical compound with the molecular formula C11H19NO2 and a molecular weight of 197.27 g/mol. IUPAC name: adamantan-1-amine;formic acid. InChIKey: PLXNIIXHHYMQNE-UHFFFAOYSA-N.
| Molecular formula | C11H19NO2 |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | adamantan-1-amine;formic acid |
| InChIKey | PLXNIIXHHYMQNE-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)N.C(=O)O |
Computed by PubChem (NCBI)