Products 1679347-22-8
CAS 1679347-22-8 appears in our catalog under these names: (S,E)-tert-Butyl 3-(oxiran-2-yl)acrylate, 97%, 97%, (S,E)-tert-Butyl 3-(oxiran-2-yl)acrylate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl (E)-3-[(2S)-oxiran-2-yl]prop-2-enoate (CAS 1679347-22-8) is a chemical compound with the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. IUPAC name: tert-butyl (E)-3-[(2S)-oxiran-2-yl]prop-2-enoate. InChIKey: NHBQGYTXVOYMEB-KPJROHGDSA-N.
| Molecular formula | C9H14O3 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | tert-butyl (E)-3-[(2S)-oxiran-2-yl]prop-2-enoate |
| InChIKey | NHBQGYTXVOYMEB-KPJROHGDSA-N |
| SMILES | CC(C)(C)OC(=O)/C=C/[C@H]1CO1 |
Computed by PubChem (NCBI)