CAS 16796-52-4 appears in our catalog under these names: 3-Bromobenzamidine hydrochloride, 3-Bromobenzimidamide hydrochloride 97%, 3-Bromobenzimidamidehydrochloride, 97%, 97%, 3-Bromobenzamidine hydrochloride, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1000mg, 2000mg, 5000mg, 250mg, 1g, 5g, 10g, 25g.
3-bromobenzenecarboximidamide;hydrochloride (CAS 16796-52-4) is a chemical compound with the molecular formula C7H8BrClN2 and a molecular weight of 235.51 g/mol. IUPAC name: 3-bromobenzenecarboximidamide;hydrochloride. InChIKey: XIZFRYIWRFNILW-UHFFFAOYSA-N.
| Molecular formula | C7H8BrClN2 |
|---|---|
| Molecular weight | 235.51 g/mol |
| IUPAC name | 3-bromobenzenecarboximidamide;hydrochloride |
| InChIKey | XIZFRYIWRFNILW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=N)N.Cl |
Computed by PubChem (NCBI)