CAS 167990-11-6 is the registry number for 1,2-Dichloro-4-(4-iodophenoxy)-benzene, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
1,2-dichloro-4-(4-iodophenoxy)benzene (CAS 167990-11-6) is a chemical compound with the molecular formula C12H7Cl2IO and a molecular weight of 364.99 g/mol. IUPAC name: 1,2-dichloro-4-(4-iodophenoxy)benzene. InChIKey: ZOYZSKWILBNMGG-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2IO |
|---|---|
| Molecular weight | 364.99 g/mol |
| IUPAC name | 1,2-dichloro-4-(4-iodophenoxy)benzene |
| InChIKey | ZOYZSKWILBNMGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC(=C(C=C2)Cl)Cl)I |
Computed by PubChem (NCBI)