CAS 1680-36-0 appears in our catalog under these names: Nonanoic anhydride, 95%, Nonanoicanhydride, 98%, Nonanoic Anhydride, Nonanoic Anhydride, >97.0%(T), Nonanoic anhydride. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, MedChemExpress. Available pack sizes: 25g, 100g, 1g, 5g, 500g, 25ml, 500ml, 5 mL.
Nonanoyl nonanoate (CAS 1680-36-0) is a chemical compound with the molecular formula C18H34O3 and a molecular weight of 298.5 g/mol. IUPAC name: nonanoyl nonanoate. InChIKey: PBBAFLCORNAZCD-UHFFFAOYSA-N.
| Molecular formula | C18H34O3 |
|---|---|
| Molecular weight | 298.5 g/mol |
| IUPAC name | nonanoyl nonanoate |
| InChIKey | PBBAFLCORNAZCD-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(=O)OC(=O)CCCCCCCC |
Computed by PubChem (NCBI)