Products 168010-17-1
CAS 168010-17-1 is the registry number for Eriosematin. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, Get quote.
5-hydroxy-2,2-dimethyl-10-(3-methylbut-2-enyl)pyrano[3,2-g]chromen-6-one (CAS 168010-17-1) is a chemical compound with the molecular formula C19H20O4 and a molecular weight of 312.4 g/mol. IUPAC name: 5-hydroxy-2,2-dimethyl-10-(3-methylbut-2-enyl)pyrano[3,2-g]chromen-6-one. InChIKey: NYFIMGDPCRCSAF-UHFFFAOYSA-N.
| Molecular formula | C19H20O4 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 5-hydroxy-2,2-dimethyl-10-(3-methylbut-2-enyl)pyrano[3,2-g]chromen-6-one |
| InChIKey | NYFIMGDPCRCSAF-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C2C(=C(C3=C1OC=CC3=O)O)C=CC(O2)(C)C)C |
Computed by PubChem (NCBI)