CAS 168021-79-2 appears in our catalog under these names: Cerovive, 95%, Cerovive, NXY–059, Disufenton sodium/ min. 98%, Disufenton sodium 99+%. Offered by: Combi-blocks, TRC, GLPBio, TargetMol, Ambeed. Available pack sizes: 1g, 250mg, 10mg, 200mg, 50mg, 5mg, 25mg, 100mg.
Disufenton Sodium is a disulfonyl derivative of phenyl-tert-butyl nitrone (PBN), with potential anti-glioma activity.
Source: ChEBI
| Molecular formula | C11H13NNa2O7S2 |
|---|---|
| Molecular weight | 381.3 g/mol |
| IUPAC name | disodium;4-[(Z)-[tert-butyl(oxido)azaniumylidene]methyl]benzene-1,3-disulfonate |
| InChIKey | XLZOVRYBVCMCGL-BPNVQINPSA-L |
| SMILES | CC(C)(C)/[N+](=C/C1=C(C=C(C=C1)S(=O)(=O)[O-])S(=O)(=O)[O-])/[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)